EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)CC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | HWXBTNAVRSUOJR-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role algal metabolite (CHEBI:84735) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role biomarker (CHEBI:59163) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role human metabolite (CHEBI:77746) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is a 2-hydroxyglutaric acid (CHEBI:17084) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is conjugate acid of (R)-2-hydroxyglutarate(2−) (CHEBI:15801) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is enantiomer of (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| Incoming Relation(s) |
| (R)-2-hydroxyglutarate(2−) (CHEBI:15801) is conjugate base of (R)-2-hydroxyglutaric acid (CHEBI:32796) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is enantiomer of (R)-2-hydroxyglutaric acid (CHEBI:32796) |
| IUPAC Name |
|---|
| (2R)-2-hydroxypentanedioic acid |
| Synonyms | Source |
|---|---|
| (R)-α-hydroxyglutaric acid | ChEBI |
| (R)-2-hydroxyglutaric acid | ChEBI |
| D-2-hydroxyglutaric acid | HMDB |
| (R)-(−)-2-hydroxyglutaric acid | ChEBI |
| (2R)-hydroxyglutaric acid | ChEBI |
| (R)-2-hydroxypentanedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01087 | KEGG COMPOUND |
| R-2-HYDROXYGLUTARATE | MetaCyc |
| HMDB0000606 | HMDB |
| FDB022139 | FooDB |
| 2HG | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723806 | Reaxys |
| CAS:13095-47-1 | ChEBI |
| Citations |
|---|