EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C5H6O5 |
| Net Charge | -1 |
| Average Mass | 147.106 |
| Monoisotopic Mass | 147.02990 |
| SMILES | O=C([O-])CCC(O)C(=O)[O-].[H+] |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/p-1 |
| InChIKey | HWXBTNAVRSUOJR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) has functional parent glutarate(1−) (CHEBI:35907) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is a 2-hydroxyglutarate (CHEBI:132941) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is conjugate acid of 2-hydroxyglutarate(2−) (CHEBI:11596) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is conjugate base of 2-hydroxyglutaric acid (CHEBI:17084) |
| Incoming Relation(s) |
| 2-hydroxyglutaric acid (CHEBI:17084) is conjugate acid of 2-hydroxyglutarate(1−) (CHEBI:36149) |
| 2-hydroxyglutarate(2−) (CHEBI:11596) is conjugate base of 2-hydroxyglutarate(1−) (CHEBI:36149) |
| IUPAC Name |
|---|
| hydrogen 2-hydroxypentanedioate |