EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O5 |
| Net Charge | 0 |
| Average Mass | 204.222 |
| Monoisotopic Mass | 204.09977 |
| SMILES | CCOC(=O)CCC(O)C(=O)OCC |
| InChI | InChI=1S/C9H16O5/c1-3-13-8(11)6-5-7(10)9(12)14-4-2/h7,10H,3-6H2,1-2H3 |
| InChIKey | DYLHSDCNOUDICA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethyl 2-hydroxypentanedioate (CHEBI:87295) has functional parent 2-hydroxyglutaric acid (CHEBI:17084) |
| diethyl 2-hydroxypentanedioate (CHEBI:87295) has role metabolite (CHEBI:25212) |
| diethyl 2-hydroxypentanedioate (CHEBI:87295) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| diethyl 2-hydroxypentanedioate (CHEBI:87295) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| diethyl 2-hydroxypentanedioate |
| Synonyms | Source |
|---|---|
| diethyl 2-hydroxyglutarate | ChEBI |
| 2-hydroxyglutaric acid diethyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726673 | Reaxys |