EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H2O3 |
| Net Charge | 0 |
| Average Mass | 74.035 |
| Monoisotopic Mass | 74.00039 |
| SMILES | [H]C(=O)C(=O)O |
| InChI | InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
| InChIKey | HHLFWLYXYJOTON-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyoxylic acid (CHEBI:16891) has role Escherichia coli metabolite (CHEBI:76971) |
| glyoxylic acid (CHEBI:16891) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| glyoxylic acid (CHEBI:16891) has role human metabolite (CHEBI:77746) |
| glyoxylic acid (CHEBI:16891) has role mouse metabolite (CHEBI:75771) |
| glyoxylic acid (CHEBI:16891) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| glyoxylic acid (CHEBI:16891) is a aldehydic acid (CHEBI:26643) |
| glyoxylic acid (CHEBI:16891) is conjugate acid of glyoxylate (CHEBI:36655) |
| Incoming Relation(s) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) has functional parent glyoxylic acid (CHEBI:16891) |
| 3,5-dihydroxyphenylglyoxylic acid (CHEBI:31104) has functional parent glyoxylic acid (CHEBI:16891) |
| 4-hydroxyphenylglyoxylic acid (CHEBI:28719) has functional parent glyoxylic acid (CHEBI:16891) |
| glyoxylate ester (CHEBI:53274) has functional parent glyoxylic acid (CHEBI:16891) |
| phenylglyoxylic acid (CHEBI:18280) has functional parent glyoxylic acid (CHEBI:16891) |
| glyoxylate (CHEBI:36655) is conjugate base of glyoxylic acid (CHEBI:16891) |
| IUPAC Name |
|---|
| oxoacetic acid |
| Synonyms | Source |
|---|---|
| formylformic acid | NIST Chemistry WebBook |
| Glyoxalate | KEGG COMPOUND |
| Glyoxalsäure | ChEBI |
| Glyoxylate | KEGG COMPOUND |
| Glyoxylic acid | KEGG COMPOUND |
| GLYOXYLIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00001186 | KNApSAcK |
| C00048 | KEGG COMPOUND |
| DB04343 | DrugBank |
| GLV | PDBeChem |
| GLYOX | MetaCyc |
| Glyoxylic_acid | Wikipedia |
| HMDB0000119 | HMDB |
| Citations |
|---|