EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO3 |
| Net Charge | 0 |
| Average Mass | 165.148 |
| Monoisotopic Mass | 165.04259 |
| SMILES | Nc1ccccc1C(=O)C(=O)O |
| InChI | InChI=1S/C8H7NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4H,9H2,(H,11,12) |
| InChIKey | MQMWPBBDMIYYMI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bradyrhizobium japonicum (ncbitaxon:375) | - | PubMed (7592320) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) has functional parent glyoxylic acid (CHEBI:16891) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) is a substituted aniline (CHEBI:48975) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) is conjugate acid of 2-aminophenylglyoxylate (CHEBI:82904) |
| Incoming Relation(s) |
| 2-aminophenylglyoxylate (CHEBI:82904) is conjugate base of 2-aminophenylglyoxylic acid (CHEBI:83716) |
| IUPAC Name |
|---|
| (2-aminophenyl)(oxo)acetic acid |
| Synonyms | Source |
|---|---|
| o-aminophenylglyoxylic acid | ChEBI |
| isatinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2691287 | Reaxys |
| Citations |
|---|