EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O5 |
| Net Charge | 0 |
| Average Mass | 182.131 |
| Monoisotopic Mass | 182.02152 |
| SMILES | O=C(O)C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C8H6O5/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,9-10H,(H,12,13) |
| InChIKey | IXVSXZQERGYQTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dihydroxyphenylglyoxylic acid (CHEBI:31104) has functional parent glyoxylic acid (CHEBI:16891) |
| 3,5-dihydroxyphenylglyoxylic acid (CHEBI:31104) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3,5-dihydroxyphenylglyoxylic acid (CHEBI:31104) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (3,5-dihydroxyphenyl)(oxo)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| C12325 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8905199 | Reaxys |