EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O4 |
| Net Charge | 0 |
| Average Mass | 166.132 |
| Monoisotopic Mass | 166.02661 |
| SMILES | O=C(O)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H6O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,9H,(H,11,12) |
| InChIKey | KXFJZKUFXHWWAJ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenylglyoxylic acid (CHEBI:28719) has functional parent glyoxylic acid (CHEBI:16891) |
| 4-hydroxyphenylglyoxylic acid (CHEBI:28719) is a phenols (CHEBI:33853) |
| 4-hydroxyphenylglyoxylic acid (CHEBI:28719) is conjugate acid of 4-hydroxyphenylglyoxylate (CHEBI:58586) |
| Incoming Relation(s) |
| 4-hydroxyphenylglyoxylate (CHEBI:58586) is conjugate base of 4-hydroxyphenylglyoxylic acid (CHEBI:28719) |
| IUPAC Name |
|---|
| (4-hydroxyphenyl)(oxo)acetic acid |
| Synonyms | Source |
|---|---|
| 4-Hydroxyphenylglyoxylate | KEGG COMPOUND |
| 4-Hydroxybenzoylformate | KEGG COMPOUND |
| 4-hydroxyphenylglyoxylate | ChEBI |
| 4-hydroxybenzoylformate | ChEBI |
| 4-Hydroxyphenylglyoxylic acid | ChemIDplus |
| Pisolithin A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:15573-67-8 | ChemIDplus |