EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h4,7,12-13,15-19,21H,2-3,5-6,8-11,14H2,1H3,(H,22,23)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | YIBNHAJFJUQSRA-YNNPMVKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H2 (CHEBI:15554) has role mouse metabolite (CHEBI:75771) |
| prostaglandin H2 (CHEBI:15554) is a olefinic compound (CHEBI:78840) |
| prostaglandin H2 (CHEBI:15554) is a oxylipin (CHEBI:61121) |
| prostaglandin H2 (CHEBI:15554) is a prostaglandins H (CHEBI:26344) |
| prostaglandin H2 (CHEBI:15554) is a secondary alcohol (CHEBI:35681) |
| prostaglandin H2 (CHEBI:15554) is conjugate acid of prostaglandin H2(1−) (CHEBI:57405) |
| Incoming Relation(s) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) has functional parent prostaglandin H2 (CHEBI:15554) |
| 2-[(9S,11R)-epidioxy-(15S)-hydroxy-(5Z,13E)-prostadienoyl]-sn-glycero-3- phosphocholine (CHEBI:138101) has functional parent prostaglandin H2 (CHEBI:15554) |
| 2-[(9S,11R)-epidioxy-(15S)-hydroxy-(5Z,13E)-prostadienoyl]-sn-glycero-3-phosphoethanolamine (CHEBI:138745) has functional parent prostaglandin H2 (CHEBI:15554) |
| prostaglandin H2 1-ethanolamide (CHEBI:53082) has functional parent prostaglandin H2 (CHEBI:15554) |
| prostaglandin H2 2-glyceryl ester (CHEBI:85166) has functional parent prostaglandin H2 (CHEBI:15554) |
| prostaglandin H2(1−) (CHEBI:57405) is conjugate base of prostaglandin H2 (CHEBI:15554) |
| IUPAC Names |
|---|
| (5Z,13E,15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoic acid |
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9α,11α,13E,15S)-9,11-epidioxy-15-hydroxyprosta-5,13-dien-1-oic acid | ChemIDplus |
| (5Z,13E)-(15S)-9alpha,11alpha-Epidioxy-15-hydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| (5Z,13E,15S)-9alpha,11alpha-Epidioxy-15-hydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| 9,11-Epoxymethano-pgh2 | ChemIDplus |
| PGH2 | KEGG COMPOUND |
| PGH2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00427 | KEGG COMPOUND |
| LMFA03010010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1598632 | Beilstein |
| CAS:42935-17-1 | KEGG COMPOUND |
| CAS:42935-17-1 | ChemIDplus |