EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CC(O)CCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H32O6/c1-14(21)7-6-8-15(22)11-12-17-16(18-13-19(17)26-25-18)9-4-2-3-5-10-20(23)24/h2,4,11-12,14-19,21-22H,3,5-10,13H2,1H3,(H,23,24)/b4-2-,12-11+/t14?,15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | MTVPUJQVDLAVML-AHYYGCRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10791960) |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) has functional parent prostaglandin H2 (CHEBI:15554) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) has role human xenobiotic metabolite (CHEBI:76967) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a bridged compound (CHEBI:35990) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a olefinic compound (CHEBI:78840) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a organic peroxide (CHEBI:25702) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a oxylipin (CHEBI:61121) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a prostaglandins H (CHEBI:26344) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is a secondary alcohol (CHEBI:35681) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is conjugate acid of 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) |
| Incoming Relation(s) |
| 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) is conjugate base of 19-hydroxyprostaglandin H2 (CHEBI:63912) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3,7-dihydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| (5Z,13E,15S)-9α,11α-epidioxy-15,19-dihydroxyprosta-5,13-dienoic acid | ChEBI |
| (5Z,9α,11α,13E,15S)-9,11-epidioxy-15,19-dihydroxyprosta-5,13-dien-1-oic acid | ChEBI |
| Citations |
|---|