EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O5 |
| Net Charge | -1 |
| Average Mass | 351.463 |
| Monoisotopic Mass | 351.21770 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h4,7,12-13,15-19,21H,2-3,5-6,8-11,14H2,1H3,(H,22,23)/p-1/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | YIBNHAJFJUQSRA-YNNPMVKQSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H2(1−) (CHEBI:57405) has role human metabolite (CHEBI:77746) |
| prostaglandin H2(1−) (CHEBI:57405) is a oxylipin anion (CHEBI:62933) |
| prostaglandin H2(1−) (CHEBI:57405) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin H2(1−) (CHEBI:57405) is conjugate base of prostaglandin H2 (CHEBI:15554) |
| Incoming Relation(s) |
| prostaglandin H2 (CHEBI:15554) is conjugate acid of prostaglandin H2(1−) (CHEBI:57405) |
| IUPAC Names |
|---|
| (5Z,13E,15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate |
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enoate |
| Synonym | Source |
|---|---|
| prostaglandin H2 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin H2 | UniProt |