EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO5 |
| Net Charge | 0 |
| Average Mass | 395.540 |
| Monoisotopic Mass | 395.26717 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)NCCO)[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C22H37NO5/c1-2-3-6-9-17(25)12-13-19-18(20-16-21(19)28-27-20)10-7-4-5-8-11-22(26)23-14-15-24/h4,7,12-13,17-21,24-25H,2-3,5-6,8-11,14-16H2,1H3,(H,23,26)/b7-4-,13-12+/t17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | GOUQZQORWGWEFM-WLOFLUCMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H2 1-ethanolamide (CHEBI:53082) has functional parent prostaglandin H2 (CHEBI:15554) |
| prostaglandin H2 1-ethanolamide (CHEBI:53082) is a N-acylethanolamine (CHEBI:52640) |
| prostaglandin H2 1-ethanolamide (CHEBI:53082) is a prostaglandins H (CHEBI:26344) |
| IUPAC Names |
|---|
| (5Z)-N-(2-hydroxyethyl)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enamide |
| (5Z,13E,15S)-9α,11α-epidioxy-15-hydroxy-N-(2-hydroxyethyl)prosta-5,13-dien-1-amide |
| UniProt Name | Source |
|---|---|
| prostamide H2 | UniProt |