EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O6 |
| Net Charge | 0 |
| Average Mass | 404.503 |
| Monoisotopic Mass | 404.21989 |
| SMILES | [H]C(=O)c1ccc(OC(=O)CCCC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c(OC)c1 |
| InChI | InChI=1S/C23H32O6/c1-15(2)18-10-8-16(3)12-20(18)29-23(26)7-5-6-22(25)28-19-11-9-17(14-24)13-21(19)27-4/h9,11,13-16,18,20H,5-8,10,12H2,1-4H3/t16-,18+,20-/m1/s1 |
| InChIKey | NTQGYDCZGXFSTE-IMFGXOCKSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) has functional parent (−)-menthol (CHEBI:15409) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) has role flavouring agent (CHEBI:35617) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) is a benzaldehydes (CHEBI:22698) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) is a diester (CHEBI:51307) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| 4-formyl-2-methoxyphenyl (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl pentanedioate |
| Synonyms | Source |
|---|---|
| 1-(4-formyl-2-methoxyphenyl) 5-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] pentanedioate | ChEBI |
| 1-(4-formyl-2-methoxyphenyl) 5-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] pentanedioic acid ester | ChEBI |
| 4-formyl-2-methoxyphenyl-(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl pentanedioate | ChEBI |
| FEMA 4958 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2308574-23-2 | ChEBI |