EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133221 - 2-oxindole-3-acetic acid
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | O=C(O)CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13) |
| InChIKey | ILGMGHZPXRDCCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS111) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS109) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS110) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS108) | ||
| Pinus sylvestris (ncbitaxon:3349) | seed (BTO:0001226) | PubMed (24225786) | |
| Zea mays (ncbitaxon:4577) | seed (BTO:0001226) | PubMed (11539687) | |
| Arabidopsis thaliana (ncbitaxon:3702) | root (BTO:0001188) | PubMed (24163311) | |
| Vitis vinifera (ncbitaxon:29760) | fruit (BTO:0000486) | PubMed (12105962) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxindole-3-acetic acid (CHEBI:133221) has role plant metabolite (CHEBI:76924) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is a indole-3-acetic acids (CHEBI:24803) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is a monocarboxylic acid (CHEBI:25384) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is a oxindoles (CHEBI:38459) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is conjugate acid of 2-oxindole-3-acetate (CHEBI:188445) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is tautomer of 2-hydroxy-(indol-3-yl)acetic acid (CHEBI:136581) |
| Incoming Relation(s) |
| N-(2-oxindole-3-acetyl)-L-aspartic acid (CHEBI:136722) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| 2-oxindole-3-acetate (CHEBI:188445) is conjugate base of 2-oxindole-3-acetic acid (CHEBI:133221) |
| 2-hydroxy-(indol-3-yl)acetic acid (CHEBI:136581) is tautomer of 2-oxindole-3-acetic acid (CHEBI:133221) |
| IUPAC Name |
|---|
| (2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid |
| Synonyms | Source |
|---|---|
| oxindole-3-acetic acid | ChEBI |
| 2-oxindol-3-yl-acetic acid | ChEBI |
| Citations |
|---|