EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO8 |
| Net Charge | 0 |
| Average Mass | 353.327 |
| Monoisotopic Mass | 353.11107 |
| SMILES | O=C(CC1C(=O)Nc2ccccc21)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H19NO8/c18-6-10-12(20)13(21)14(22)16(24-10)25-11(19)5-8-7-3-1-2-4-9(7)17-15(8)23/h1-4,8,10,12-14,16,18,20-22H,5-6H2,(H,17,23)/t8?,10-,12-,13+,14-,16+/m1/s1 |
| InChIKey | MLVJTFNIARPUAO-LCNORDJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) is a O-acyl carbohydrate (CHEBI:52782) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) is a oxindoles (CHEBI:38459) |
| 1-(2-oxindole-3-acetyl)-β-D-glucose (CHEBI:136930) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-[(2-oxo-2,3-dihydro-1H-indol-3-yl)acetyl]-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-oxindole-3-acetyl-β-D-glucose | MetaCyc |
| 1-(2-oxindol-3-ylacetyl)-β-D-glucose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9592 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11077869 | Reaxys |