EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO3 |
| Net Charge | -1 |
| Average Mass | 190.178 |
| Monoisotopic Mass | 190.05097 |
| SMILES | O=C([O-])CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)/p-1 |
| InChIKey | ILGMGHZPXRDCCS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxindole-3-acetate (CHEBI:188445) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-oxindole-3-acetate (CHEBI:188445) is conjugate base of 2-oxindole-3-acetic acid (CHEBI:133221) |
| Incoming Relation(s) |
| 2-oxindole-3-acetic acid (CHEBI:133221) is conjugate acid of 2-oxindole-3-acetate (CHEBI:188445) |
| UniProt Name | Source |
|---|---|
| 2-oxindole-3-acetate | UniProt |
| Citations |
|---|