EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O6 |
| Net Charge | 0 |
| Average Mass | 306.274 |
| Monoisotopic Mass | 306.08519 |
| SMILES | O=C(O)C[C@H](NC(=O)CC1C(=O)Nc2ccccc21)C(=O)O |
| InChI | InChI=1S/C14H14N2O6/c17-11(15-10(14(21)22)6-12(18)19)5-8-7-3-1-2-4-9(7)16-13(8)20/h1-4,8,10H,5-6H2,(H,15,17)(H,16,20)(H,18,19)(H,21,22)/t8?,10-/m0/s1 |
| InChIKey | SDOOMIWSQMGJCL-HTLJXXAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | PubMed (27500669) | ||
| - | MetaboLights (MTBLS312) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-oxindole-3-acetyl)-L-aspartic acid (CHEBI:136722) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| N-(2-oxindole-3-acetyl)-L-aspartic acid (CHEBI:136722) has role Brassica napus metabolite (CHEBI:140165) |
| N-(2-oxindole-3-acetyl)-L-aspartic acid (CHEBI:136722) is a N-acyl-L-aspartic acid (CHEBI:21647) |
| N-(2-oxindole-3-acetyl)-L-aspartic acid (CHEBI:136722) is a oxindoles (CHEBI:38459) |
| IUPAC Name |
|---|
| N-[(2-oxo-2,3-dihydro-1H-indol-3-yl)acetyl]-L-aspartic acid |
| Synonym | Source |
|---|---|
| 2-oxindole-3-acetyl-L-aspartic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-OXINDOLE-3-ACETYL-ASP | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11077849 | Reaxys |