EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136944 - 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside
| Formula | C16H19NO9 |
| Net Charge | 0 |
| Average Mass | 369.326 |
| Monoisotopic Mass | 369.10598 |
| SMILES | O=C(O)CC1C(=O)Nc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc21 |
| InChI | InChI=1S/C16H19NO9/c18-5-9-12(21)13(22)14(23)16(26-9)25-8-3-1-2-6-7(4-10(19)20)15(24)17-11(6)8/h1-3,7,9,12-14,16,18,21-23H,4-5H2,(H,17,24)(H,19,20)/t7?,9-,12-,13+,14-,16-/m1/s1 |
| InChIKey | GJXGLYODFWLYHO-PNNKGAHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) | ||
| Zea mays (ncbitaxon:4577) | - | PubMed (4044604) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) has functional parent 2-oxindole-3-acetic acid (CHEBI:133221) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) is a monosaccharide derivative (CHEBI:63367) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) is a oxindoles (CHEBI:38459) |
| 7-hydroxy-2-oxindole-3-acetic acid β-D-glucoside (CHEBI:136944) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| [7-(β-D-glucopyranosyloxy)-2-oxo-2,3-dihydro-1H-indol-3-yl]acetic acid |
| Synonyms | Source |
|---|---|
| 7-hydroxy-2-oxindole-3-acetic acid β-glucoside | ChEBI |
| 7-hydroxy-2-oxindole-3-acetic acid glucoside | ChEBI |
| 7-(β-D-glucosyloxy)-2-oxindole-3-acetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 7-HYDROXY-2-OXINDOLE-3-ACETIC-ACID-GLUCO | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21408246 | Reaxys |
| CAS:95061-84-0 | ChemIDplus |
| Citations |
|---|