EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | GMVPRGQOIOIIMI-DWKJAMRDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. renoprotective agent Any compound that is able to prevent damage to the kidneys. vasodilator agent A drug used to cause dilation of the blood vessels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E1 (CHEBI:15544) has role anticoagulant (CHEBI:50249) |
| prostaglandin E1 (CHEBI:15544) has role antineoplastic agent (CHEBI:35610) |
| prostaglandin E1 (CHEBI:15544) has role antiviral agent (CHEBI:22587) |
| prostaglandin E1 (CHEBI:15544) has role cardiovascular drug (CHEBI:35554) |
| prostaglandin E1 (CHEBI:15544) has role human metabolite (CHEBI:77746) |
| prostaglandin E1 (CHEBI:15544) has role ophthalmology drug (CHEBI:66981) |
| prostaglandin E1 (CHEBI:15544) has role platelet aggregation inhibitor (CHEBI:50427) |
| prostaglandin E1 (CHEBI:15544) has role renoprotective agent (CHEBI:231911) |
| prostaglandin E1 (CHEBI:15544) has role vasodilator agent (CHEBI:35620) |
| prostaglandin E1 (CHEBI:15544) is a prostaglandins E (CHEBI:26338) |
| prostaglandin E1 (CHEBI:15544) is conjugate acid of prostaglandin E1(1−) (CHEBI:57397) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) has functional parent prostaglandin E1 (CHEBI:15544) |
| 15-dehydro-prostaglandin E1 (CHEBI:15548) has functional parent prostaglandin E1 (CHEBI:15544) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) has functional parent prostaglandin E1 (CHEBI:15544) |
| 6-oxoprostaglandin E1 (CHEBI:28269) has functional parent prostaglandin E1 (CHEBI:15544) |
| prostaglandin E1(1−) (CHEBI:57397) is conjugate base of prostaglandin E1 (CHEBI:15544) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15-dihydroxy-9-oxoprost-13-en-1-oic acid |
| INNs | Source |
|---|---|
| alprostadil | KEGG DRUG |
| alprostadil | WHO MedNet |
| alprostadilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (11α,13E,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oic acid | ChemIDplus |
| 11α,15α-dihydroxy-9-oxo-13-trans-prostenoic acid | ChemIDplus |
| (13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate | KEGG COMPOUND |
| (13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate | KEGG COMPOUND |
| alprostadil | ChEMBL |
| Alprostadil | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Befar | KEGG DRUG |
| Caverject | DrugBank |
| Caverject impulse | ChEMBL |
| Edex | DrugBank |
| Muse | DrugBank |
| Prostin VR | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 138 | DrugCentral |
| C04741 | KEGG COMPOUND |
| D00180 | KEGG DRUG |
| DB00770 | DrugBank |
| HMDB0001442 | HMDB |
| LMFA03010134 | LIPID MAPS |
| Prostaglandin_E1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2061617 | Reaxys |
| CAS:745-65-3 | KEGG COMPOUND |
| CAS:745-65-3 | ChemIDplus |
| Citations |
|---|