EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO3 |
| Net Charge | 0 |
| Average Mass | 311.381 |
| Monoisotopic Mass | 311.15214 |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C19H21NO3/c1-20-9-8-19-12-5-7-15(22-3)18(19)23-17-14(21-2)6-4-11(16(17)19)10-13(12)20/h4-7,13,18H,8-10H2,1-3H3/t13-,18+,19+/m1/s1 |
| InChIKey | FQXXSQDCDRQNQE-VMDGZTHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thebaine (CHEBI:9519) has functional parent oripavine (CHEBI:7782) |
| thebaine (CHEBI:9519) is a morphinane alkaloid (CHEBI:25418) |
| thebaine (CHEBI:9519) is a organic heteropentacyclic compound (CHEBI:38164) |
| thebaine (CHEBI:9519) is conjugate base of thebaine(1+) (CHEBI:59953) |
| Incoming Relation(s) |
| oxycodone (CHEBI:7852) has functional parent thebaine (CHEBI:9519) |
| thebaine(1+) (CHEBI:59953) is conjugate acid of thebaine (CHEBI:9519) |
| IUPAC Name |
|---|
| 3,6-dimethoxy-17-methyl-6,7,8,14-tetradehydro-4,5α-epoxymorphinan |
| Synonyms | Source |
|---|---|
| 3-O-methyl-oripavin | ChemIDplus |
| 4,5α-epoxy-3,6-dimethoxy-17-methyl-6,8-morphinadien | ChemIDplus |
| (5R,9R,13S)-4,5-epoxy-3,6-dimethoxy-9α-methyl-6,8-morphinadien | ChemIDplus |
| (5α)-6,7,8,14-tetradehydro-4,5-epoxy-3,6-dimethoxy-17-methylmorphinan | NIST Chemistry WebBook |
| paramorphine | ChemIDplus |
| Thebaine | KEGG COMPOUND |
| Citations |
|---|