EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO3 |
| Net Charge | 0 |
| Average Mass | 297.354 |
| Monoisotopic Mass | 297.13649 |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,12,17,20H,7-9H2,1-2H3/t12-,17+,18+/m1/s1 |
| InChIKey | ZKLXUUYLEHCAMF-UUWFMWQGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (37132502) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oripavine (CHEBI:7782) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| oripavine (CHEBI:7782) has role opioid analgesic (CHEBI:35482) |
| oripavine (CHEBI:7782) is a ether (CHEBI:25698) |
| oripavine (CHEBI:7782) is a morphinane alkaloid (CHEBI:25418) |
| oripavine (CHEBI:7782) is a organic heteropentacyclic compound (CHEBI:38164) |
| oripavine (CHEBI:7782) is a organic hydroxy compound (CHEBI:33822) |
| oripavine (CHEBI:7782) is a tertiary amino compound (CHEBI:50996) |
| oripavine (CHEBI:7782) is conjugate base of oripavine(1+) (CHEBI:194499) |
| Incoming Relation(s) |
| thebaine (CHEBI:9519) has functional parent oripavine (CHEBI:7782) |
| oripavine(1+) (CHEBI:194499) is conjugate acid of oripavine (CHEBI:7782) |
| IUPAC Name |
|---|
| 6-methoxy-17-methyl-5α-6,7,8,14-tetradehydro-4,5-epoxymorphinan-3-ol |
| Synonyms | Source |
|---|---|
| 3-O-demethylthebaine | ChEBI |
| (5α)-6,7,8,14-tetradehydro-4,5-epoxy-6-methoxy-17-methylmorphinan-3-ol | ChEBI |
| 6,7,8,14-tetradehydro-4,5α-epoxy-6-methoxy-17-methyl-morphinan-3-ol | ChEBI |
| oripavine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| AU2008203048 | Patent |
| AU2008231127 | Patent |
| C00028775 | KNApSAcK |
| C06175 | KEGG COMPOUND |
| FDB002075 | FooDB |
| HMDB0030251 | HMDB |
| Oripavine | Wikipedia |
| US2010113787 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:467-04-9 | KNApSAcK |
| Citations |
|---|