EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO3 |
| Net Charge | 0 |
| Average Mass | 297.354 |
| Monoisotopic Mass | 297.13649 |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,12,17,20H,7-9H2,1-2H3/t12-,17+,18+/m1/s1 |
| InChIKey | ZKLXUUYLEHCAMF-UUWFMWQGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (37132502) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oripavine (CHEBI:7782) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| oripavine (CHEBI:7782) has role opioid analgesic (CHEBI:35482) |
| oripavine (CHEBI:7782) is a ether (CHEBI:25698) |
| oripavine (CHEBI:7782) is a morphinane alkaloid (CHEBI:25418) |
| oripavine (CHEBI:7782) is a organic heteropentacyclic compound (CHEBI:38164) |
| oripavine (CHEBI:7782) is a organic hydroxy compound (CHEBI:33822) |
| oripavine (CHEBI:7782) is a tertiary amino compound (CHEBI:50996) |
| oripavine (CHEBI:7782) is conjugate base of oripavine(1+) (CHEBI:194499) |
| Incoming Relation(s) |
| thebaine (CHEBI:9519) has functional parent oripavine (CHEBI:7782) |
| oripavine(1+) (CHEBI:194499) is conjugate acid of oripavine (CHEBI:7782) |
| IUPAC Name |
|---|
| 6-methoxy-17-methyl-5α-6,7,8,14-tetradehydro-4,5-epoxymorphinan-3-ol |
| Synonyms | Source |
|---|---|
| 3-O-demethylthebaine | ChEBI |
| (5α)-6,7,8,14-tetradehydro-4,5-epoxy-6-methoxy-17-methylmorphinan-3-ol | ChEBI |
| 6,7,8,14-tetradehydro-4,5α-epoxy-6-methoxy-17-methyl-morphinan-3-ol | ChEBI |
| oripavine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| AU2008203048 | Patent |
| AU2008231127 | Patent |
| C00028775 | KNApSAcK |
| C06175 | KEGG COMPOUND |
| FDB002075 | FooDB |
| HMDB0030251 | HMDB |
| Oripavine | Wikipedia |
| US2010113787 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:467-04-9 | KNApSAcK |
| Citations |
|---|