EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22NO3 |
| Net Charge | +1 |
| Average Mass | 312.389 |
| Monoisotopic Mass | 312.15942 |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(OC)c5c4[C@@]2(CC[NH+]3C)[C@H]1O5 |
| InChI | InChI=1S/C19H21NO3/c1-20-9-8-19-12-5-7-15(22-3)18(19)23-17-14(21-2)6-4-11(16(17)19)10-13(12)20/h4-7,13,18H,8-10H2,1-3H3/p+1/t13-,18+,19+/m1/s1 |
| InChIKey | FQXXSQDCDRQNQE-VMDGZTHMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thebaine(1+) (CHEBI:59953) is a ammonium ion derivative (CHEBI:35274) |
| thebaine(1+) (CHEBI:59953) is conjugate acid of thebaine (CHEBI:9519) |
| Incoming Relation(s) |
| thebaine (CHEBI:9519) is conjugate base of thebaine(1+) (CHEBI:59953) |
| IUPAC Name |
|---|
| 3,6-dimethoxy-17-methyl-6,7,8,14-tetradehydro-4,5α-epoxymorphinan-17-ium |
| UniProt Name | Source |
|---|---|
| thebaine | UniProt |
| Citations |
|---|