EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N2O5 |
| Net Charge | 0 |
| Average Mass | 392.411 |
| Monoisotopic Mass | 392.13722 |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
| InChIKey | FJHBVJOVLFPMQE-QFIPXVFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SN-38 (CHEBI:8988) has role antineoplastic agent (CHEBI:35610) |
| SN-38 (CHEBI:8988) has role apoptosis inducer (CHEBI:68495) |
| SN-38 (CHEBI:8988) has role drug metabolite (CHEBI:49103) |
| SN-38 (CHEBI:8988) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| SN-38 (CHEBI:8988) is a phenols (CHEBI:33853) |
| SN-38 (CHEBI:8988) is a pyranoindolizinoquinoline (CHEBI:48626) |
| SN-38 (CHEBI:8988) is a tertiary alcohol (CHEBI:26878) |
| SN-38 (CHEBI:8988) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| irinotecan (CHEBI:80630) has functional parent SN-38 (CHEBI:8988) |
| SN-38 carboxylic acid (CHEBI:149481) has functional parent SN-38 (CHEBI:8988) |
| IUPAC Name |
|---|
| (4S)-4,11-diethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| Synonyms | Source |
|---|---|
| 10-Hydroxy-7-ethylcamptothecin | ChemIDplus |
| 7-Ethyl-10-hydroxy-20(S)-camptothecin | ChemIDplus |
| 7-Ethyl-10-hydroxycamptothecin | ChemIDplus |
| NK 012 | ChemIDplus |
| NK-012 | ChemIDplus |
| SN 38 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| SN-38 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11173 | KEGG COMPOUND |
| HMDB0060510 | HMDB |
| RS4 | PDBeChem |
| SN-38 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4829984 | Reaxys |
| CAS:86639-52-3 | KEGG COMPOUND |
| CAS:86639-52-3 | ChemIDplus |
| Citations |
|---|