EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O6 |
| Net Charge | 0 |
| Average Mass | 410.426 |
| Monoisotopic Mass | 410.14779 |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc([C@@](O)(CC)C(=O)O)c(CO)c(=O)n1C2 |
| InChI | InChI=1S/C22H22N2O6/c1-3-12-13-7-11(26)5-6-17(13)23-19-14(12)9-24-18(19)8-16(15(10-25)20(24)27)22(30,4-2)21(28)29/h5-8,25-26,30H,3-4,9-10H2,1-2H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | IRKZFHZUIBLGKU-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SN-38 carboxylic acid (CHEBI:149481) has functional parent SN-38 (CHEBI:8988) |
| SN-38 carboxylic acid (CHEBI:149481) has role drug metabolite (CHEBI:49103) |
| SN-38 carboxylic acid (CHEBI:149481) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| SN-38 carboxylic acid (CHEBI:149481) is a enone (CHEBI:51689) |
| SN-38 carboxylic acid (CHEBI:149481) is a organic heterotetracyclic compound (CHEBI:38163) |
| SN-38 carboxylic acid (CHEBI:149481) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| SN-38 carboxylic acid (CHEBI:149481) is a phenols (CHEBI:33853) |
| SN-38 carboxylic acid (CHEBI:149481) is a primary alcohol (CHEBI:15734) |
| SN-38 carboxylic acid (CHEBI:149481) is a tertiary alcohol (CHEBI:26878) |
| SN-38 carboxylic acid (CHEBI:149481) is conjugate acid of SN-38 carboxylate (CHEBI:8989) |
| Incoming Relation(s) |
| SN-38 carboxylate (CHEBI:8989) is conjugate base of SN-38 carboxylic acid (CHEBI:149481) |
| IUPAC Name |
|---|
| (2S)-2-[12-ethyl-2-hydroxy-8-(hydroxymethyl)-9-oxo-9,11-dihydroindolizino[1,2-b]quinolin-7-yl]-2-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| SN-38C | ChEBI |
| SN-38 carboxylic acid form | ChEBI |
| Citations |
|---|