EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O6 |
| Net Charge | 0 |
| Average Mass | 586.689 |
| Monoisotopic Mass | 586.27913 |
| SMILES | CCc1c2c(nc3ccc(OC(=O)N4CCC(N5CCCCC5)CC4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C33H38N4O6/c1-3-22-23-16-21(43-32(40)36-14-10-20(11-15-36)35-12-6-5-7-13-35)8-9-27(23)34-29-24(22)18-37-28(29)17-26-25(30(37)38)19-42-31(39)33(26,41)4-2/h8-9,16-17,20,41H,3-7,10-15,18-19H2,1-2H3/t33-/m0/s1 |
| InChIKey | UWKQSNNFCGGAFS-XIFFEERXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irinotecan (CHEBI:80630) has functional parent SN-38 (CHEBI:8988) |
| irinotecan (CHEBI:80630) has role antineoplastic agent (CHEBI:35610) |
| irinotecan (CHEBI:80630) has role apoptosis inducer (CHEBI:68495) |
| irinotecan (CHEBI:80630) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| irinotecan (CHEBI:80630) has role prodrug (CHEBI:50266) |
| irinotecan (CHEBI:80630) is a N-acylpiperidine (CHEBI:48591) |
| irinotecan (CHEBI:80630) is a carbamate ester (CHEBI:23003) |
| irinotecan (CHEBI:80630) is a pyranoindolizinoquinoline (CHEBI:48626) |
| irinotecan (CHEBI:80630) is a ring assembly (CHEBI:36820) |
| irinotecan (CHEBI:80630) is a tertiary alcohol (CHEBI:26878) |
| irinotecan (CHEBI:80630) is a tertiary amino compound (CHEBI:50996) |
| irinotecan (CHEBI:80630) is a δ-lactone (CHEBI:18946) |
| irinotecan (CHEBI:80630) is conjugate base of irinotecan(1+) (CHEBI:90895) |
| Incoming Relation(s) |
| irinotecan(1+) (CHEBI:90895) is conjugate acid of irinotecan (CHEBI:80630) |
| IUPAC Name |
|---|
| (4S)-4,11-diethyl-4-hydroxy-3,14-dioxo-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl [1,4'-bipiperidine]-1'-carboxylate |
| INNs | Source |
|---|---|
| irinotecan | ChemIDplus |
| irinotecanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Biotecan | ChEMBL |
| HSDB 7607 | ChemIDplus |
| Irinophore C | ChemIDplus |
| (+)-Irinotecan | ChemIDplus |
| Irinotecan lactone | ChemIDplus |
| Irinotecan mylan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1482 | DrugCentral |
| C16641 | KEGG COMPOUND |
| CP0 | PDBeChem |
| D08086 | KEGG DRUG |
| DB00762 | DrugBank |
| HMDB0014900 | HMDB |
| Irinotecan | Wikipedia |
| LSM-2167 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4839096 | Reaxys |
| CAS:97682-44-5 | ChemIDplus |
| CAS:97682-44-5 | KEGG COMPOUND |
| Citations |
|---|