EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | CCC/C=C/C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/b5-4+ |
| InChIKey | NIONDZDPPYHYKY-SNAWJCMRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-hexenoic acid (CHEBI:87721) has role metabolite (CHEBI:25212) |
| (2E)-hexenoic acid (CHEBI:87721) is a 2-hexenoic acid (CHEBI:61206) |
| (2E)-hexenoic acid (CHEBI:87721) is conjugate acid of (2E)-hexenoate (CHEBI:87722) |
| Incoming Relation(s) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) has functional parent (2E)-hexenoic acid (CHEBI:87721) |
| (2E)-hexenoate (CHEBI:87722) is conjugate base of (2E)-hexenoic acid (CHEBI:87721) |
| IUPAC Name |
|---|
| (2E)-hex-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-2-Hexenoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720443 | Reaxys |
| CAS:13419-69-7 | ChemIDplus |
| CAS:13419-69-7 | NIST Chemistry WebBook |
| Citations |
|---|