EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | [H]C(CCC)=C([H])C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8) |
| InChIKey | NIONDZDPPYHYKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hexenoic acid (CHEBI:61206) is a hexenoic acid (CHEBI:24580) |
| 2-hexenoic acid (CHEBI:61206) is a short-chain fatty acid (CHEBI:26666) |
| 2-hexenoic acid (CHEBI:61206) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| ethyl 2-hexenoate (CHEBI:87514) has functional parent 2-hexenoic acid (CHEBI:61206) |
| (2E)-hexenoic acid (CHEBI:87721) is a 2-hexenoic acid (CHEBI:61206) |
| IUPAC Name |
|---|
| hex-2-enoic acid |
| Synonyms | Source |
|---|---|
| hex-2-enoic acids | ChEBI |
| C6:1, n-4 | ChEBI |
| 2-hexenoic acids | ChEBI |
| Hex-2-ensäure | ChEBI |
| α,β-hexenoic acid | ChEBI |
| α.β-Hexensäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720441 | Reaxys |