EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CCC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5+ |
| InChIKey | NTWSIWWJPQHFTO-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) has functional parent (2E)-hexenoic acid (CHEBI:87721) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) is a monounsaturated fatty acid (CHEBI:25413) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) is a short-chain fatty acid (CHEBI:26666) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) is conjugate acid of (2E)-3-methylhex-2-enoate (CHEBI:143558) |
| Incoming Relation(s) |
| (2E)-3-methylhex-2-enoate (CHEBI:143558) is conjugate base of (2E)-3-methylhex-2-enoic acid (CHEBI:144845) |
| IUPAC Name |
|---|
| (2E)-3-methylhex-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-3-methyl-2-hexenoic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-21073 | MetaCyc |
| Trans-3-Methyl-2-hexenoic_acid | Wikipedia |
| WO1993007853 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:27960-21-0 | ChemIDplus |
| Citations |
|---|