EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O2 |
| Net Charge | -1 |
| Average Mass | 113.136 |
| Monoisotopic Mass | 113.06080 |
| SMILES | CCC/C=C/C(=O)[O-] |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/p-1/b5-4+ |
| InChIKey | NIONDZDPPYHYKY-SNAWJCMRSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-hexenoate (CHEBI:87722) has role metabolite (CHEBI:25212) |
| (2E)-hexenoate (CHEBI:87722) is a monounsaturated fatty acid anion (CHEBI:82680) |
| (2E)-hexenoate (CHEBI:87722) is conjugate base of (2E)-hexenoic acid (CHEBI:87721) |
| Incoming Relation(s) |
| (2E)-hexenoic acid (CHEBI:87721) is conjugate acid of (2E)-hexenoate (CHEBI:87722) |
| IUPAC Name |
|---|
| (2E)-hex-2-enoate |