EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H11O9 |
| Net Charge | -3 |
| Average Mass | 419.321 |
| Monoisotopic Mass | 419.04195 |
| SMILES | O=C([O-])C1=CC(=C(c2ccc(O)c(C(=O)[O-])c2)c2ccc(O)c(C(=O)[O-])c2)C=CC1=O |
| InChI | InChI=1S/C22H14O9/c23-16-4-1-10(7-13(16)20(26)27)19(11-2-5-17(24)14(8-11)21(28)29)12-3-6-18(25)15(9-12)22(30)31/h1-9,23-24H,(H,26,27)(H,28,29)(H,30,31)/p-3 |
| InChIKey | GIXWDMTZECRIJT-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurintricarboxylate (CHEBI:87396) is a tricarboxylic acid trianion (CHEBI:27092) |
| aurintricarboxylate (CHEBI:87396) is conjugate base of aurintricarboxylic acid (CHEBI:87397) |
| Incoming Relation(s) |
| aluminon (CHEBI:87398) has part aurintricarboxylate (CHEBI:87396) |
| chrome violet CG (CHEBI:87394) has part aurintricarboxylate (CHEBI:87396) |
| aurintricarboxylic acid (CHEBI:87397) is conjugate acid of aurintricarboxylate (CHEBI:87396) |
| IUPAC Name |
|---|
| 3,3'-[(3-carboxylato-4-oxocyclohexa-2,5-dien-1-ylidene)methylene]bis(6-hydroxybenzoate) |