EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14O9 |
| Net Charge | 0 |
| Average Mass | 422.345 |
| Monoisotopic Mass | 422.06378 |
| SMILES | O=C(O)C1=CC(=C(c2ccc(O)c(C(=O)O)c2)c2ccc(O)c(C(=O)O)c2)C=CC1=O |
| InChI | InChI=1S/C22H14O9/c23-16-4-1-10(7-13(16)20(26)27)19(11-2-5-17(24)14(8-11)21(28)29)12-3-6-18(25)15(9-12)22(30)31/h1-9,23-24H,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | GIXWDMTZECRIJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurintricarboxylic acid (CHEBI:87397) has role fluorochrome (CHEBI:51217) |
| aurintricarboxylic acid (CHEBI:87397) has role histological dye (CHEBI:77178) |
| aurintricarboxylic acid (CHEBI:87397) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| aurintricarboxylic acid (CHEBI:87397) is a monohydroxybenzoic acid (CHEBI:25389) |
| aurintricarboxylic acid (CHEBI:87397) is a quinomethanes (CHEBI:52404) |
| aurintricarboxylic acid (CHEBI:87397) is a tricarboxylic acid (CHEBI:27093) |
| aurintricarboxylic acid (CHEBI:87397) is conjugate acid of aurintricarboxylate (CHEBI:87396) |
| Incoming Relation(s) |
| aurintricarboxylate (CHEBI:87396) is conjugate base of aurintricarboxylic acid (CHEBI:87397) |
| IUPAC Name |
|---|
| 3,3'-[(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methylene]bis(6-hydroxybenzoic acid) |
| Synonyms | Source |
|---|---|
| 5,5'-(3-Carboxy-4-oxocyclohexa-2,5-dienylidenemethylene)di(salicylic acid) | ChEBI |
| Aluminon free acid | ChEBI |
| chrome violet CG free acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Aurintricarboxylic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2228904 | Reaxys |
| CAS:4431-00-9 | ChemIDplus |
| Citations |
|---|