EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H11O9.3H4N |
| Net Charge | 0 |
| Average Mass | 473.438 |
| Monoisotopic Mass | 473.14343 |
| SMILES | O=C([O-])C1=CC(=C(c2ccc(O)c(C(=O)[O-])c2)c2ccc(O)c(C(=O)[O-])c2)C=CC1=O.[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C22H14O9.3H3N/c23-16-4-1-10(7-13(16)20(26)27)19(11-2-5-17(24)14(8-11)21(28)29)12-3-6-18(25)15(9-12)22(30)31;;;/h1-9,23-24H,(H,26,27)(H,28,29)(H,30,31);3*1H3 |
| InChIKey | AIPNSHNRCQOTRI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aluminon (CHEBI:87398) has part aurintricarboxylate (CHEBI:87396) |
| aluminon (CHEBI:87398) has role fluorochrome (CHEBI:51217) |
| aluminon (CHEBI:87398) has role histological dye (CHEBI:77178) |
| aluminon (CHEBI:87398) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| aluminon (CHEBI:87398) is a ammonium salt (CHEBI:47704) |
| IUPAC Name |
|---|
| trisammonium 3,3'-[(3-carboxylato-4-oxocyclohexa-2,5-dien-1-ylidene)methylene]bis(6-hydroxybenzoate) |
| Synonyms | Source |
|---|---|
| mordant violet 39 | ChEBI |
| C.I. 43810 | ChEBI |
| Aurintricarboxylic acid triammonium salt | ChemIDplus |
| Ammonium aurintricarboxylate | ChemIDplus |
| Aurintricarboxylic acid ammonium salt | ChemIDplus |
| Triammonium 5,5'-(3-carboxylato-4-oxocyclohexa-2,5-dienylidenemethylene)disalicylate | ChemIDplus |
| Citations |
|---|