EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H11O9.3Na |
| Net Charge | 0 |
| Average Mass | 488.291 |
| Monoisotopic Mass | 488.00961 |
| SMILES | O=C([O-])C1=CC(=C(c2ccc(O)c(C(=O)[O-])c2)c2ccc(O)c(C(=O)[O-])c2)C=CC1=O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C22H14O9.3Na/c23-16-4-1-10(7-13(16)20(26)27)19(11-2-5-17(24)14(8-11)21(28)29)12-3-6-18(25)15(9-12)22(30)31;;;/h1-9,23-24H,(H,26,27)(H,28,29)(H,30,31);;;/q;3*+1/p-3 |
| InChIKey | XWOVYFGIWQEHHR-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Biological Role: | insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrome violet CG (CHEBI:87394) has part aurintricarboxylate (CHEBI:87396) |
| chrome violet CG (CHEBI:87394) has role fluorochrome (CHEBI:51217) |
| chrome violet CG (CHEBI:87394) has role histological dye (CHEBI:77178) |
| chrome violet CG (CHEBI:87394) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| chrome violet CG (CHEBI:87394) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| trisodium 3,3'-[(3-carboxylato-4-oxocyclohexa-2,5-dien-1-ylidene)methylene]bis(6-hydroxybenzoate) |
| Synonyms | Source |
|---|---|
| Aurintricarboxylic acid trisodium salt | ChemIDplus |
| C.I. 43810 | ChEBI |
| C.I. Mordant Violet 39 | ChemIDplus |
| C.I. Mordant Violet 39, trisodium salt | ChemIDplus |
| mordant violet 39 | ChEBI |
| Trisodium 5,5'-(3-carboxylato-4-oxocyclohexa-2,5-dienylidenemethylene)di(salicylate) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10230203 | Reaxys |
| CAS:13186-45-3 | ChemIDplus |