EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N5O8S |
| Net Charge | -1 |
| Average Mass | 460.489 |
| Monoisotopic Mass | 460.15076 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc(S(=O)C[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-])n1)C(=O)[O-] |
| InChI | InChI=1S/C17H27N5O8S/c1-22(2,3)12(16(28)29)6-9-7-19-17(20-9)31(30)8-11(15(26)27)21-13(23)5-4-10(18)14(24)25/h7,10-12H,4-6,8,18H2,1-3H3,(H4-,19,20,21,23,24,25,26,27,28,29)/p-1/t10-,11-,12-,31?/m0/s1 |
| InChIKey | SJHLSLUUWIBQNS-TYLCEOGASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) has functional parent Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) is a peptide anion (CHEBI:60334) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) is conjugate base of Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) is conjugate acid of Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-5-{[(1R)-1-carboxylato-2-({4-[(2S)-2-carboxylato-2-(trimethylammonio)ethyl]-1H-imidazol-2-yl}sulfinyl)ethyl]amino}-5-oxopentanoate |
| UniProt Name | Source |
|---|---|
| γ-L-glutamyl-hercynylcysteine S-oxide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15279 | MetaCyc |
| Citations |
|---|