EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O7 |
| Net Charge | 0 |
| Average Mass | 320.382 |
| Monoisotopic Mass | 320.18350 |
| SMILES | C[C@H](CCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O7/c1-9(5-3-4-6-11(16)7-14(19)20)21-15-13(18)8-12(17)10(2)22-15/h9-13,15-18H,3-8H2,1-2H3,(H,19,20)/t9-,10+,11-,12-,13-,15-/m1/s1 |
| InChIKey | WNUSOZJRAZSLBP-AOWZIMASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) mutants and small amounts in acox-1(ok2257) mutant C. elegans. |
| Panagrellus redivivus (ncbitaxon:6233) | - | PubMed (23213209) | Produced by female |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#10 (CHEBI:79223) has functional parent (3R,8R)-3,8-dihydroxynonanoic acid (CHEBI:79224) |
| bhas#10 (CHEBI:79223) has functional parent ascr#10 (CHEBI:78838) |
| bhas#10 (CHEBI:79223) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#10 (CHEBI:79223) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#10 (CHEBI:79223) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#10 (CHEBI:79223) is a monocarboxylic acid (CHEBI:25384) |
| bhas#10 (CHEBI:79223) is conjugate acid of bhas#10(1-) (CHEBI:139719) |
| Incoming Relation(s) |
| ibha#10 (CHEBI:79334) has functional parent bhas#10 (CHEBI:79223) |
| bhas#10(1-) (CHEBI:139719) is conjugate base of bhas#10 (CHEBI:79223) |
| IUPAC Name |
|---|
| (3R,8R)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxynonanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-8R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2310%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233403 | Reaxys |
| CAS:1355682-49-3 | SMID |
| Citations |
|---|