EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O6 |
| Net Charge | 0 |
| Average Mass | 304.383 |
| Monoisotopic Mass | 304.18859 |
| SMILES | C[C@H](CCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O6/c1-10(7-5-3-4-6-8-14(18)19)20-15-13(17)9-12(16)11(2)21-15/h10-13,15-17H,3-9H2,1-2H3,(H,18,19)/t10-,11+,12-,13-,15-/m1/s1 |
| InChIKey | MILZHQPVNOSJIP-WPLOAARJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Absent in daf-22(ok693) but is a major ascaroside detected in wild type (N2) and acox-1(ok2257) mutant C. elegans. Detected in dhs-28(hj8) and maoc-1(hj13) mutant C. elegans |
| Panagrellus redivivus (ncbitaxon:6233) | - | PubMed (23213209) | Produced by female P. redivivus. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#10 (CHEBI:78838) has functional parent (8R)-8-hydroxynonanoic acid (CHEBI:78839) |
| ascr#10 (CHEBI:78838) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#10 (CHEBI:78838) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#10 (CHEBI:78838) is a monocarboxylic acid (CHEBI:25384) |
| ascr#10 (CHEBI:78838) is conjugate acid of ascr#10(1−) (CHEBI:139615) |
| Incoming Relation(s) |
| ascr#10-CoA (CHEBI:139616) has functional parent ascr#10 (CHEBI:78838) |
| bhas#10 (CHEBI:79223) has functional parent ascr#10 (CHEBI:78838) |
| glas#10 (CHEBI:79301) has functional parent ascr#10 (CHEBI:78838) |
| hbas#10 (CHEBI:79330) has functional parent ascr#10 (CHEBI:78838) |
| icas#10 (CHEBI:79029) has functional parent ascr#10 (CHEBI:78838) |
| mbas#10 (CHEBI:79129) has functional parent ascr#10 (CHEBI:78838) |
| ascr#10(1−) (CHEBI:139615) is conjugate base of ascr#10 (CHEBI:78838) |
| IUPAC Name |
|---|
| (8R)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonanoic acid |
| Synonyms | Source |
|---|---|
| 8R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonanoic acid | SMID |
| asc-C9 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2310%0D | SMID |
| LMFA13040008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233395 | Reaxys |
| CAS:1355681-08-1 | SMID |
| Citations |
|---|