EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27O7 |
| Net Charge | -1 |
| Average Mass | 319.374 |
| Monoisotopic Mass | 319.17623 |
| SMILES | C[C@H](CCCC[C@@H](O)CC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O7/c1-9(5-3-4-6-11(16)7-14(19)20)21-15-13(18)8-12(17)10(2)22-15/h9-13,15-18H,3-8H2,1-2H3,(H,19,20)/p-1/t9-,10+,11-,12-,13-,15-/m1/s1 |
| InChIKey | WNUSOZJRAZSLBP-AOWZIMASSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#10(1-) (CHEBI:139719) is a organic molecular entity (CHEBI:50860) |
| bhas#10(1-) (CHEBI:139719) is conjugate base of bhas#10 (CHEBI:79223) |
| Incoming Relation(s) |
| bhas#10 (CHEBI:79223) is conjugate acid of bhas#10(1-) (CHEBI:139719) |