EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO8 |
| Net Charge | 0 |
| Average Mass | 463.527 |
| Monoisotopic Mass | 463.22062 |
| SMILES | C[C@H](CCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C24H33NO8/c1-14(7-3-4-8-16(26)11-22(28)29)31-24-20(27)12-21(15(2)32-24)33-23(30)18-13-25-19-10-6-5-9-17(18)19/h5-6,9-10,13-16,20-21,24-27H,3-4,7-8,11-12H2,1-2H3,(H,28,29)/t14-,15+,16-,20-,21-,24-/m1/s1 |
| InChIKey | RHSYRFCZUCKPGK-IQWQIVRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibha#10 (CHEBI:79334) has functional parent (3R,8R)-3,8-dihydroxynonanoic acid (CHEBI:79224) |
| ibha#10 (CHEBI:79334) has functional parent bhas#10 (CHEBI:79223) |
| ibha#10 (CHEBI:79334) has functional parent icas#10 (CHEBI:79029) |
| ibha#10 (CHEBI:79334) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibha#10 (CHEBI:79334) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ibha#10 (CHEBI:79334) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibha#10 (CHEBI:79334) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibha#10 (CHEBI:79334) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R,8R)-8-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxynonanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-8R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ibha%2310 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233473 | Reaxys |
| CAS:1355683-20-3 | SMID |
| Citations |
|---|