EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O3 |
| Net Charge | 0 |
| Average Mass | 326.521 |
| Monoisotopic Mass | 326.28210 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C20H38O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h16,18,21H,1-15,17,19H2,(H,22,23)/b18-16+ |
| InChIKey | RMDYFFMMLMZFSY-FBMGVBCBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) has functional parent trans-2-icosenoic acid (CHEBI:79014) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#35 (CHEBI:79157) has functional parent (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) |
| IUPAC Name |
|---|
| (2E)-20-hydroxyicos-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-ω-hydroxyicos-2-enoic acid | ChEBI |
| trans-20-hydroxyicos-2-enoic acid | ChEBI |
| (2E)-20-hydroxyeicos-2-enoic acid | ChEBI |