EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCCCCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h18-19H,2-17H2,1H3,(H,21,22)/b19-18+ |
| InChIKey | FIKTURVKRGQNQD-VHEBQXMUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-icosenoic acid (CHEBI:79014) is a icosenoic acid (CHEBI:23902) |
| trans-2-icosenoic acid (CHEBI:79014) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) has functional parent trans-2-icosenoic acid (CHEBI:79014) |
| (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) has functional parent trans-2-icosenoic acid (CHEBI:79014) |
| IUPAC Names |
|---|
| (2E)-2-eicosenoic acid |
| (2E)-2-icosenoic acid |
| (2E)-eicos-2-enoic acid |
| (2E)-icos-2-enoic acid |
| (E)-2-eicosenoic acid |
| (E)-2-icosenoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11329706 | Reaxys |
| CAS:26764-41-0 | ChemIDplus |