EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H48O6 |
| Net Charge | 0 |
| Average Mass | 456.664 |
| Monoisotopic Mass | 456.34509 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H48O6/c1-22-23(27)21-24(28)26(32-22)31-20-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-25(29)30/h17,19,22-24,26-28H,2-16,18,20-21H2,1H3,(H,29,30)/b19-17+/t22-,23+,24+,26+/m0/s1 |
| InChIKey | AIUNLQUMHTUTNR-YHGVQZPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13) and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#35 (CHEBI:79157) has functional parent (2E)-20-hydroxyicos-2-enoic acid (CHEBI:79184) |
| oscr#35 (CHEBI:79157) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#35 (CHEBI:79157) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| oscr#35 (CHEBI:79157) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#35 (CHEBI:79157) is conjugate acid of oscr#35(1−) (CHEBI:140041) |
| Incoming Relation(s) |
| oscr#35-CoA (CHEBI:140042) has functional parent oscr#35 (CHEBI:79157) |
| oscr#35(1−) (CHEBI:140041) is conjugate base of oscr#35 (CHEBI:79157) |
| IUPAC Name |
|---|
| (2E)-20-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]icos-2-enoic acid |
| Synonym | Source |
|---|---|
| 20-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-icosenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2335 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233497 | Reaxys |
| CAS:1355682-41-5 | SMID |
| Citations |
|---|