EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C18H34O3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h14,16,19H,1-13,15,17H2,(H,20,21)/b16-14+ |
| InChIKey | JQNQKNGCSLCPDE-JQIJEIRASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) has functional parent trans-octadec-2-enoic acid (CHEBI:50572) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#31 (CHEBI:79153) has functional parent (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) |
| IUPAC Name |
|---|
| (2E)-18-hydroxyoctadec-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-18-hydroxyoctadec-2-enoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18655794 | Reaxys |