EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H44O6 |
| Net Charge | 0 |
| Average Mass | 428.610 |
| Monoisotopic Mass | 428.31379 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C24H44O6/c1-20-21(25)19-22(26)24(30-20)29-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-23(27)28/h15,17,20-22,24-26H,2-14,16,18-19H2,1H3,(H,27,28)/b17-15+/t20-,21+,22+,24+/m0/s1 |
| InChIKey | VXOVWFJOWNESCS-PGYXGQNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#31 (CHEBI:79153) has functional parent (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) |
| oscr#31 (CHEBI:79153) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#31 (CHEBI:79153) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| oscr#31 (CHEBI:79153) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#31 (CHEBI:79153) is conjugate acid of oscr#31(1−) (CHEBI:140029) |
| Incoming Relation(s) |
| oscr#31-CoA (CHEBI:140030) has functional parent oscr#31 (CHEBI:79153) |
| oscr#31(1−) (CHEBI:140029) is conjugate base of oscr#31 (CHEBI:79153) |
| IUPAC Name |
|---|
| (2E)-18-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octadec-2-enoic acid |
| Synonym | Source |
|---|---|
| 18-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-octadecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2331 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233467 | Reaxys |
| CAS:1355682-33-5 | SMID |
| Citations |
|---|