EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | CCCCCCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/b17-16+ |
| InChIKey | LKOVPWSSZFDYPG-WUKNDPDISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-octadec-2-enoic acid (CHEBI:50572) is a octadec-2-enoic acid (CHEBI:50573) |
| Incoming Relation(s) |
| (2E,17R)-17-hydroxyoctadec-2-enoic acid (CHEBI:79002) has functional parent trans-octadec-2-enoic acid (CHEBI:50572) |
| (2E)-18-hydroxyoctadec-2-enoic acid (CHEBI:79178) has functional parent trans-octadec-2-enoic acid (CHEBI:50572) |
| trans-2-octadecenoyl-CoA (CHEBI:50570) has functional parent trans-octadec-2-enoic acid (CHEBI:50572) |
| IUPAC Name |
|---|
| (2E)-octadec-2-enoic acid |
| Synonyms | Source |
|---|---|
| trans-2-oleic acid | LIPID MAPS |
| trans-2-octadecenoic acid | LIPID MAPS |
| Octadec-2t-ensäure | ChEBI |
| trans-Heptadecen-(1)-carbonsäure | ChEBI |
| (E)-2-octadecenoic acid | ChEBI |
| octadec-2t-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030062 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725695 | Reaxys |