EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O3 |
| Net Charge | 0 |
| Average Mass | 214.305 |
| Monoisotopic Mass | 214.15689 |
| SMILES | O=C(O)/C=C/CCCCCCCCCO |
| InChI | InChI=1S/C12H22O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h8,10,13H,1-7,9,11H2,(H,14,15)/b10-8+ |
| InChIKey | RILFOORPZLBCJK-CSKARUKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) has functional parent trans-2-dodecenoic acid (CHEBI:37162) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) is a ω-hydroxy-medium-chain fatty acid (CHEBI:194303) |
| Incoming Relation(s) |
| oscr#19 (CHEBI:79141) has functional parent (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) |
| IUPAC Name |
|---|
| (2E)-12-hydroxydodec-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907998 | Reaxys |