EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | CCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+ |
| InChIKey | PAWGRNGPMLVJQH-ZHACJKMWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-dodecenoic acid (CHEBI:37162) has functional parent (E)-dodec-2-enal (CHEBI:133741) |
| trans-2-dodecenoic acid (CHEBI:37162) is a 2-dodecenoic acid (CHEBI:38371) |
| trans-2-dodecenoic acid (CHEBI:37162) is conjugate acid of (E)-dodec-2-enoate (CHEBI:84274) |
| Incoming Relation(s) |
| (2E)-11-hydroxy-2-dodecenoic acid (CHEBI:141391) has functional parent trans-2-dodecenoic acid (CHEBI:37162) |
| (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) has functional parent trans-2-dodecenoic acid (CHEBI:37162) |
| trans-dodec-2-enoyl-CoA (CHEBI:15471) has functional parent trans-2-dodecenoic acid (CHEBI:37162) |
| isariotin F (CHEBI:66086) has functional parent trans-2-dodecenoic acid (CHEBI:37162) |
| (E)-dodec-2-enoate (CHEBI:84274) is conjugate base of trans-2-dodecenoic acid (CHEBI:37162) |
| IUPAC Name |
|---|
| (2E)-dodec-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-lauroleic acid | LIPID MAPS |
| trans-dodec-2-enoic acid | ChEBI |
| 2t-Dodecensäure | ChEBI |
| 12:1, n-10 trans | ChEBI |
| C12:1, n-10 trans | ChEBI |
| (E)-2-dodecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030037 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722819 | Reaxys |
| Citations |
|---|