EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O6 |
| Net Charge | 0 |
| Average Mass | 344.448 |
| Monoisotopic Mass | 344.21989 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H32O6/c1-14-15(19)13-16(20)18(24-14)23-12-10-8-6-4-2-3-5-7-9-11-17(21)22/h9,11,14-16,18-20H,2-8,10,12-13H2,1H3,(H,21,22)/b11-9+/t14-,15+,16+,18+/m0/s1 |
| InChIKey | CBFGNQUTSUMTTO-XIWSQWRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13) and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#19 (CHEBI:79141) has functional parent (2E)-12-hydroxydodec-2-enoic acid (CHEBI:79164) |
| oscr#19 (CHEBI:79141) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#19 (CHEBI:79141) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| oscr#19 (CHEBI:79141) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#19 (CHEBI:79141) is conjugate acid of oscr#19(1−) (CHEBI:139990) |
| Incoming Relation(s) |
| oscr#19-CoA (CHEBI:139991) has functional parent oscr#19 (CHEBI:79141) |
| oscr#19(1−) (CHEBI:139990) is conjugate base of oscr#19 (CHEBI:79141) |
| IUPAC Name |
|---|
| (2E)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]dodec-2-enoic acid |
| Synonym | Source |
|---|---|
| 12-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-dodecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2319 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233414 | Reaxys |
| CAS:1355682-11-9 | SMID |
| Citations |
|---|