EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31O6 |
| Net Charge | -1 |
| Average Mass | 343.440 |
| Monoisotopic Mass | 343.21261 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H32O6/c1-14-15(19)13-16(20)18(24-14)23-12-10-8-6-4-2-3-5-7-9-11-17(21)22/h9,11,14-16,18-20H,2-8,10,12-13H2,1H3,(H,21,22)/p-1/b11-9+/t14-,15+,16+,18+/m0/s1 |
| InChIKey | CBFGNQUTSUMTTO-XIWSQWRSSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#19(1−) (CHEBI:139990) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#19(1−) (CHEBI:139990) is conjugate base of oscr#19 (CHEBI:79141) |
| Incoming Relation(s) |
| oscr#19 (CHEBI:79141) is conjugate acid of oscr#19(1−) (CHEBI:139990) |
| IUPAC Name |
|---|
| (2E)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]dodec-2-enoate |