EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O6 |
| Net Charge | 0 |
| Average Mass | 248.275 |
| Monoisotopic Mass | 248.12599 |
| SMILES | C[C@@H]1O[C@@H](OCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C11H20O6/c1-7-8(12)6-9(13)11(17-7)16-5-3-2-4-10(14)15/h7-9,11-13H,2-6H2,1H3,(H,14,15)/t7-,8+,9+,11+/m0/s1 |
| InChIKey | RGLRYSHQCRBEIV-YSSBGUOXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms and is a major ascaroside in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#9 (CHEBI:79133) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| oscr#9 (CHEBI:79133) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#9 (CHEBI:79133) is a monocarboxylic acid (CHEBI:25384) |
| oscr#9 (CHEBI:79133) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#9 (CHEBI:79133) is conjugate acid of oscr#9(1−) (CHEBI:140058) |
| Incoming Relation(s) |
| icos#9 (CHEBI:79116) has functional parent oscr#9 (CHEBI:79133) |
| oscr#9-CoA (CHEBI:140059) has functional parent oscr#9 (CHEBI:79133) |
| oscr#9(1−) (CHEBI:140058) is conjugate base of oscr#9 (CHEBI:79133) |
| IUPAC Name |
|---|
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentanoic acid |
| Synonym | Source |
|---|---|
| 5-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-pentanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%239 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233383 | Reaxys |
| CAS:1355681-20-7 | SMID |
| Citations |
|---|