EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19O6 |
| Net Charge | -1 |
| Average Mass | 247.267 |
| Monoisotopic Mass | 247.11871 |
| SMILES | C[C@@H]1O[C@@H](OCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C11H20O6/c1-7-8(12)6-9(13)11(17-7)16-5-3-2-4-10(14)15/h7-9,11-13H,2-6H2,1H3,(H,14,15)/p-1/t7-,8+,9+,11+/m0/s1 |
| InChIKey | RGLRYSHQCRBEIV-YSSBGUOXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#9(1−) (CHEBI:140058) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#9(1−) (CHEBI:140058) is conjugate base of oscr#9 (CHEBI:79133) |
| Incoming Relation(s) |
| oscr#9 (CHEBI:79133) is conjugate acid of oscr#9(1−) (CHEBI:140058) |
| IUPAC Name |
|---|
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentanoate |