EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54N7O21P3S |
| Net Charge | 0 |
| Average Mass | 997.801 |
| Monoisotopic Mass | 997.23063 |
| SMILES | C[C@@H]1O[C@@H](OCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C32H54N7O21P3S/c1-17-18(40)12-19(41)31(57-17)54-10-5-4-6-22(43)64-11-9-34-21(42)7-8-35-29(46)26(45)32(2,3)14-56-63(52,53)60-62(50,51)55-13-20-25(59-61(47,48)49)24(44)30(58-20)39-16-38-23-27(33)36-15-37-28(23)39/h15-20,24-26,30-31,40-41,44-45H,4-14H2,1-3H3,(H,34,42)(H,35,46)(H,50,51)(H,52,53)(H2,33,36,37)(H2,47,48,49)/t17-,18+,19+,20+,24+,25+,26-,30+,31+/m0/s1 |
| InChIKey | OJJVYBQJWBBERR-XKGQWQQESA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#9-CoA (CHEBI:140059) has functional parent oscr#9 (CHEBI:79133) |
| oscr#9-CoA (CHEBI:140059) is a acyl-CoA (CHEBI:17984) |
| oscr#9-CoA (CHEBI:140059) is conjugate acid of oscr#9-CoA(4−) (CHEBI:140060) |
| Incoming Relation(s) |
| oscr#9-CoA(4−) (CHEBI:140060) is conjugate base of oscr#9-CoA (CHEBI:140059) |
| Synonyms | Source |
|---|---|
| oscr#9-coenzyme A | ChEBI |
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentanoyl-CoA | ChEBI |
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentanoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6QA | PDBeChem |
| Citations |
|---|